| Identification | |
| Name: | Bradykinin |
| Synonyms: | Arginine,N2-[N-[1-[N-[N-[N-[1-(1-arginyl-L-prolyl)-L-prolyl]glycyl]-3-phenylalanyl]seryl]prolyl]-3-phenylalanyl]-(6CI); 1020: PN: EP2071336 PAGE: 73 unclaimed sequence; 1021: PN: WO2006091861SEQID: 1021 claimed protein; 107: PN: WO2006069765 SEQID: 107 claimed protein;10: PN: WO2008008766 SEQID: 124 unclaimed sequence; 111: PN: WO2008058016SEQID: 112 claimed protein; 115: PN: WO2008104000 TABLE: 4 unclaimed sequence;11: PN: US20040209344 SEQID: 7 unclaimed protein; 13: PN: WO0023092 SEQID: 13unclaimed protein; 147: PN: US20030119021 SEQID: 25 unclaimed protein; 14: PN:US20090088553 SEQID: 88 unclaimed protein; 14: PN: US6525021 SEQID: 13unclaimed protein; 153: PN: WO2006067198 SEQID: 165 claimed protein; 156: PN:WO2009126292 TABLE: 4 unclaimed sequence; 15: PN: US6258776 SEQID: 24 unclaimedprotein; 15: PN: WO2007058336 SEQID: 15 claimed sequence; 165: PN:US20050175581 SEQID: 165 unclaimed protein; 16: PN: WO2006079099 SEQID: 1unclaimed protein; 175: PN: WO2008008805 SEQID: 178 unclaimed protein; 187: PN:US20030176421 PAGE: 54-55 claimed protein; 18: PN: JP2006280210 SEQID: 18unclaimed protein; 19: PN: US20060223140 SEQID: 18 claimed protein; 19: PN:WO2007022248 SEQID: 19 claimed protein; 1: PN: CN101344527 PAGE: 6 claimedsequence; 1: PN: JP2005049164 SEQID: 1 claimed protein; 1: PN: US20040198666SEQID: 1 unclaimed protein; 1: PN: US20040220110 PAGE: 2 unclaimed protein; 1:PN: US20070015715 SEQID: 1 unclaimed sequence; 1: PN: US7605120 SEQID: 1unclaimed sequence; 1: PN: WO02102835 SEQID: 3 unclaimed protein; 1: PN:WO2006130718 SEQID: 1 unclaimed protein; 1: PN: WO2006134125 SEQID: 22 claimedprotein; 227: PN: WO2009118205 PAGE: 176 unclaimed sequence; 229: PN:US20090048431 SEQID: 227 claimed sequence; 24: PN: US20080226503 TABLE: 1unclaimed sequence; 2: PN: WO2005042027 SEQID: 1 unclaimed protein; 2: PN:WO2005057221 PAGE: 17 unclaimed protein; 360: PN: WO2009117524 SEQID: 5unclaimed sequence; 38: PN: WO2006017688 SEQID: 38 unclaimed protein; |
| CAS: | 58-82-2 |
| EINECS: | 227-781-2 |
| Molecular Formula: | C50H73 N15 O11 |
| Molecular Weight: | 252.3128 |
| InChI: | InChI=1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
| Molecular Structure: | ![(C50H73N15O11) Arginine,N2-[N-[1-[N-[N-[N-[1-(1-arginyl-L-prolyl)-L-prolyl]glycyl]-3-phenylalanyl]seryl]prolyl]-3-p...](https://img1.guidechem.com/chem/e/dict/47/58-82-2.jpg) |
| Properties | |
| Melting Point: | 170ºC |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.49 g/cm3 |
| Refractive index: | 1.693 |
| Water Solubility: | H2O: >40 mg/mL |
| Solubility: | H2O: >40 mg/mL |
| Specification: |
Bradykinin (58-82-2) also can be Synthetic bradykinin .And it is a peptide that could cause blood pressure to lower.It is a physiologically and pharmacologically active peptide of the kinin group of proteins, consisting of nine amino acids.As a class of drugs called ACE inhibitors, which are used to lower blood pressure, increase bradykinin further lowering blood pressure. Bradykinin works on blood vessels through the release of prostacyclin, nitric oxide, and Endothelium-Derived Hyperpolarizing Factor.
|
| Flash Point: | °C |
| Storage Temperature: | −20°C |
| Color: | White crystalline solid Colorless crystals |
| Safety Data | |
 |
|
