| Identification | |
| Name: | 2-Bromonaphthalene |
| Synonyms: | 2-Naphthyl bromide;NSC 4011;b-Bromonaphthalene;b-Naphthyl bromide; |
| CAS: | 580-13-2 |
| EINECS: | 209-452-5 |
| Molecular Formula: | C10H7Br |
| Molecular Weight: | 207.06658 |
| InChI: | InChI=1S/C10H7Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Melting Point: | 53-57 oC |
| Flash Point: | 127.8oC |
| Boiling Point: | 282.7oC at 760 mmHg |
| Density: | 1.481g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6382 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | White crystalline powder. |
| Specification: |
?2-Bromonaphthalene (CAS NO.580-13-2) is also named as 2-Naphthyl bromide ; AI3-19928 ; NSC 4011 ; beta-Bromonaphthalene ; beta-Naphthyl bromide?; 2-Bromonaphthalene ; Naphthalene, 2-bromo- .?2-Bromonaphthalene is white or pale yellow powder.?It is insoluble in water, and soluble in alcohol, ether, benzene, chloroform. |
| HS Code: | 29036990 |
| Flash Point: | 127.8oC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
T: Toxic
|
 |
|
