| Identification | |
| Name: | 3-quinolylamine |
| Synonyms: | 3-Aminoquinoline |
| CAS: | 580-17-6 |
| EINECS: | 209-455-1 |
| Molecular Formula: | C9H8N2 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C9H8N2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-6H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61850? |
| Density: | 1.21 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.708 |
| Water Solubility: | slightly soluble in hot water |
| Solubility: | methanol: 0.1 g/mL, clear,slightly soluble in hot water |
| Appearance: | beige crystals |
| Specification: |
?3-Aminoquinoline (580-17-6) is a quinazoline derivative with the appearance of white to pale pink crystalline powder. It is?also called 3-Amino-quinolin ; 3-Quinolineamine ; Quinoline, 3-amino- ; 3-Quinolinamine ; 3-Quinolylamine ; 3-Aminoquinoline ; Timtec-bb sbb004125 ; Quinolin-3-amine . 3-Aminoquinoline (580-17-6) is used as a pharmaceutical intermediate. Although it is stable at room temperature in closed containers under normal storage and handling conditions, it also should? be stored in a tightly closed container when not in use and stored in a cool, dry,well-ventilated area away from incompatible substances. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29334990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
