| Identification | |
| Name: | 1,3,5-Triazine-2,4-diamine,6-chloro-N2,N2,N4,N4-tetraethyl- |
| Synonyms: | 1,3,5-Triazine-2,4-diamine,6-chloro-N,N,N',N'-tetraethyl- (9CI); Geigy 444 (6CI); s-Triazine, 2-chloro-4,6-bis(diethylamino)-(8CI); 2,4-Bis(diethylamino)-6-chloro-1,3,5-triazine;2,4-Bis(diethylamino)-6-chloro-s-triazine;2-Chloro-4,6-bis(diethylamino)-s-triazine; Chlorazin; Chlorazine; G 25,804; G444E; Geigy 444E; Geigy Herbicide 444E; NSC 56355; NSC 56840 |
| CAS: | 580-48-3 |
| EINECS: | 209-459-3 |
| Molecular Formula: | C11H20 Cl N5 |
| Molecular Weight: | 257.81 |
| InChI: | InChI=1/C11H20ClN5/c1-5-16(6-2)10-13-9(12)14-11(15-10)17(7-3)8-4/h5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 27 DEG C |
| Flash Point: | 188.3°C |
| Boiling Point: | 387.7°Cat760mmHg |
| Density: | 1.155g/cm3 |
| Refractive index: | 1.564 |
| Solubility: | FREELY SOL IN HYDROCARBONS, CHLORINATED HYDROCARBONS, LOWER MOLECULAR WT ALCOHOLS, & KETONES 0.0009% in water @ 22 deg C > 10% in benzene > 10% in chloroform > 10% in ligroin |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 188.3°C |
| Color: | CRYSTALS OR OILY LIQUID |
| Safety Data | |
 |
|
