| Identification | |
| Name: | Phenol,4,4'-[(1Z,3Z)-2,3-diisocyano-1,3-butadiene-1,4-diyl]bis- |
| Synonyms: | Ethyleneisocyanide, bis(p-hydroxybenzylidene)- (6CI,7CI,8CI);(1Z,3Z)-2,3-Diisocyano-1,4-bis(4-hydroxyphenyl)buta-1,3-diene;1,4-Bis(p-hydroxyphenyl)-2,3-diisonitrilo-1,3-butadiene; Brevicid; Brevicide;Brevicide X; NSC 179485; NSC 227183; Ophthocillin; Trianthil; Xanthocillin X;Xantocillin; Xantyrid |
| CAS: | 580-74-5 |
| EINECS: | 234-271-3 |
| Molecular Formula: | C18H12 N2 O2 |
| Molecular Weight: | 288.32 |
| InChI: | InChI=1/C18H12N2O2/c1-19-17(11-13-3-7-15(21)8-4-13)18(20-2)12-14-5-9-16(22)10-6-14/h3-12,21-22H/b17-11-,18-12- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
