| Identification | |
| Name: | Ethanol,2-[ethyl(3-methyl-4-nitrosophenyl)amino]- |
| Synonyms: | 2-[ethyl(3-methyl-4-nitrosophenyl)amino]ethanol |
| CAS: | 58066-96-9 |
| EINECS: | 261-090-7 |
| Molecular Formula: | C11H16 N2 O2 |
| Molecular Weight: | 208.29 |
| InChI: | InChI=1/C11H16N2O2/c1-3-13(6-7-14)10-4-5-11(12-15)9(2)8-10/h4-5,8,14H,3,6-7H2,1-2H3 |
| Molecular Structure: | ![(C11H16N2O2) 2-[ethyl(3-methyl-4-nitrosophenyl)amino]ethanol](https://img1.guidechem.com/chem/e/dict/113/58066-96-9.jpg) |
| Properties | |
| Flash Point: | 182°C |
| Boiling Point: | 377.3°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.535 |
| Specification: |
N-Ethyl-N-(2-hydroxyethyl)-3-methyl-4-nitrosoaniline , its cas register number is 58066-96-9. It also can be called 2-(Ethyl(3-methyl-4-nitrosophenyl)amino)ethanol ; EINECS 261-090-7 .is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-hydroxyethyl analogue of MDA. When N-Ethyl-N-(2-hydroxyethyl)-3-methyl-4-nitrosoaniline (CAS NO.58066-96-9) is heated to decomposition, it emits toxic vapors of NOx. |
| Flash Point: | 182°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
