| Identification | |
| Name: | 3-Butenenitrile,2-hydroxy- |
| Synonyms: | 1-Cyano-1-hydroxy-2-propene;2-Hydroxy-3-butenenitrile; 2-Hydroxy-3-butenylnitrile; 2-Propenal, cyanohydrin;Acrolein cyanohydrin; Vinylglycolonitrile |
| CAS: | 5809-59-6 |
| EINECS: | 227-371-3 |
| Molecular Formula: | C4H5 N O |
| Molecular Weight: | 83.10 |
| InChI: | InChI=1/C4H5NO/c1-2-4(6)3-5/h2,4,6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 71.9°C |
| Boiling Point: | 195.2°Cat760mmHg |
| Density: | 1.026g/cm3 |
| Refractive index: | 1.449 |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 71.9°C |
| Safety Data | |
 |
|
