| Identification | |
| Name: | 2-Thiophenecarboxamide |
| Synonyms: | 2-(Aminocarbonyl)thiophene;2-Thenamide; NSC 109369 |
| CAS: | 5813-89-8 |
| EINECS: | 238-028-2 |
| Molecular Formula: | C5H5 N O S |
| Molecular Weight: | 127.16 |
| InChI: | InChI=1/C5H5NOS/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 181-183 °C(lit.) |
| Flash Point: | 143.4°C |
| Boiling Point: | 313.5°C at 760 mmHg |
| Density: | 1.302g/cm3 |
| Refractive index: | 1.603 |
| Specification: | white crystalline powder Safety Statements:36/37/39-26-22 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| Flash Point: | 143.4°C |
| Safety Data | |
 |
|
