| Identification | |
| Name: | 2,7-dimethylnaphthalene |
| Synonyms: | 2,7-Dimethylnaphthalene;NSC 36851 |
| CAS: | 582-16-1 |
| EINECS: | 209-477-1 |
| Molecular Formula: | C12H12 |
| Molecular Weight: | 156.2237 |
| InChI: | InChI=1S/C12H12/c1-9-3-5-11-6-4-10(2)8-12(11)7-9/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 94-97 °C(lit.) |
| Flash Point: | 110.5°C |
| Boiling Point: | 263 °C(lit.) |
| Density: | 1g/cm3 |
| Refractive index: | 1.604 |
| Specification: |
Naphthalene,2,7-dimethyl- , its cas register number is 582-16-1. It also can be called 2,7-Dimethylnaphthalene ; Naphthalene, 2,7-dimethyl- (8CI)(9CI) .It is a white to beige powder or flakes. |
| Flash Point: | 110.5°C |
| Safety Data | |
 |
|
