| Identification |
| Name: | 2,7-Dihydroxynaphthalene |
| Synonyms: | 2,7-Naphthalenediol; 2,7-Dihydroxy Napthalene |
| CAS: | 582-17-2 |
| EINECS: | 209-478-7 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C10H8O2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6,11-12H |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | Decomposes |
| Boiling Point: | Decomposes |
| Density: | 1.33 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.725 |
| Water Solubility: | insoluble |
| Solubility: | Soluble in hot water AUTOIGNITION |
| Appearance: | off white to grey powder |
| HS Code: | 29072900 |
| Flash Point: | Decomposes |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
