| Identification | |
| Name: | Piperidine,4-(diphenylmethoxy)- |
| Synonyms: | 4-(4-Benzhydryloxy)piperidine;4-(Benzhydryloxy)piperidine;4-(Diphenylmethoxy)piperidine; |
| CAS: | 58258-01-8 |
| Molecular Formula: | C18H21NO |
| Molecular Weight: | 267.37 |
| InChI: | InChI=1/C18H21NO/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)20-17-11-13-19-14-12-17/h1-10,17-19H,11-14H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.9°C |
| Boiling Point: | 383.5°C at 760 mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.589 |
| Appearance: | low melting light-brown solid |
| Specification: | Low Melting Light-Brown Solid usageEng:A metabolite of Ebastine |
| Flash Point: | 162.9°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Ebastine |
| Safety Data | |
 |
|
