Identification |
Name: | chloroethylene; ethyl prop-2-enoate; 3-methylbuta-1,3-dien-2-ol |
Synonyms: | AC1O57Q3;Chloroethene, polymer with methyl 2-propenoate and ethyl 2-propenoate;Chloroethene, methyl 2-propenoate, ethyl 2-propenoate polymer;chloroethene; ethyl prop-2-enoate; 3-methylbuta-1,3-dien-2-ol;2-Propenoic acid, ethyl ester, polymer with chloroethene and methyl 2-propenoate;58295-64-0 |
CAS: | 58295-64-0 |
Molecular Formula: | C12H19ClO3 |
Molecular Weight: | 246.7305 |
InChI: | InChI=1/C5H8O2.C5H8O.C2H3Cl/c1-3-5(6)7-4-2;1-4(2)5(3)6;1-2-3/h3H,1,4H2,2H3;6H,1,3H2,2H3;2H,1H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 15.6°C |
Safety Data |
|
|