Identification |
Name: | Benzenemethanol, a-butyl- |
CAS: | 583-03-9 |
EINECS: | 209-493-9 |
Molecular Formula: | C11H16O |
Molecular Weight: | 164.27 |
InChI: | InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 110.7ºC |
Boiling Point: | 137ºC 2mm |
Density: | 0,96 g/cm3 |
Refractive index: | 1.5080 |
Specification: |
Fenipentol ,its cas register number is 583-03-9. It also can be called 1-Phenyl-1-hydroxypentane ; 1-Phenylpentan-1-ol ; Butyl hydroxy toluene ; Benzenemethanol, .alpha.-butyl- and .alpha.-Butylbenzyl alcohol .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 110.7ºC |
Safety Data |
|
|