| Identification | |
| Name: | Benzenemethanol, a-butyl- |
| CAS: | 583-03-9 |
| EINECS: | 209-493-9 |
| Molecular Formula: | C11H16O |
| Molecular Weight: | 164.27 |
| InChI: | InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.7ºC |
| Boiling Point: | 137ºC 2mm |
| Density: | 0,96 g/cm3 |
| Refractive index: | 1.5080 |
| Specification: |
Fenipentol ,its cas register number is 583-03-9. It also can be called 1-Phenyl-1-hydroxypentane ; 1-Phenylpentan-1-ol ; Butyl hydroxy toluene ; Benzenemethanol, .alpha.-butyl- and .alpha.-Butylbenzyl alcohol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 110.7ºC |
| Safety Data | |
 |
|
