Identification |
Name: | 2-Butenoic acid,4-oxo-4-phenyl- |
Synonyms: | Acrylicacid, 3-benzoyl- (6CI,7CI,8CI);Acrylic acid, b-benzoyl- (2CI);3-Benzoylacrylic acid;4-Oxo-4-phenylcrotonic acid;Benzoylacrylic acid;NSC 143;b-Benzoylacrylic acid; |
CAS: | 583-06-2 |
EINECS: | 209-496-5 |
Molecular Formula: | C10H8O3 |
Molecular Weight: | 176.1687 |
InChI: | InChI=1S/C10H8O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-7H,(H,12,13)/b7-6+ |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 6 |
Density: | 1.238 g/cm3 |
Appearance: | white solid |
Specification: | YELLOW TO YELLOW-BROWN CRYST. NEEDLES OR POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |