| Identification | |
| Name: | 2-Methylcyclohexanol |
| Synonyms: | 2-Methylcyclohexanol, mixture of cis and trans; 2-Methylcyclohexyl alcohol |
| CAS: | 583-59-5 |
| EINECS: | 209-512-0 |
| Molecular Formula: | C7H14O |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2617 3/PG 3 |
| Density: | 0.93 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4615-1.4635 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in water |
| Appearance: | viscous liquid |
| Specification: |
Conditions to Avoid: Incompatible materials, ignition sources.Chemical Stability: Not available |
| Packinggroup: | III |
| HS Code: | 29061200 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
