| Identification | |
| Name: | 2-Methylcyclohexanone |
| Synonyms: | - |
| CAS: | 583-60-8 |
| EINECS: | 209-513-6 |
| Molecular Formula: | C7H12O |
| Molecular Weight: | 112.17 |
| InChI: | InChI=1/C7H12O/c1-6-4-2-3-5-7(6)8/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2297 |
| Density: | 0.924 |
| Refractive index: | 1.447-1.449 |
| Solubility: | Insol in water; sol in alcohol and ether |
| Specification: |
2-Methylcyclohexanone , with CAS number of 583-60-8, can be called 2-Methyl-cyclohexanon ; 2-Methyl-1-cyclohexanone ; Methylanon ; alpha-Methylcyclohexanone ; o-Methylcyclohexanone . 2-Methylcyclohexanone (CAS NO.583-60-8) is used as a solvent. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Color: | Water-white to pale yellow liquid Colorless liquid Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
