| Identification | |
| Name: | 3-Methoxy-17-methyl-15H-cyclopentaphanthrene |
| Synonyms: | 3-Methoxy-17-methylgona-1,3,5,7,9,11,13,16-octaene;gona-1,3,5,7,9,11,13,16-octaene, 3-methoxy-17-methyl- |
| CAS: | 5831-08-3 |
| Molecular Formula: | C19H16O |
| Molecular Weight: | 260.3297 |
| InChI: | InChI=1/C19H16O/c1-12-3-6-17-15(12)9-10-18-16-8-5-14(20-2)11-13(16)4-7-19(17)18/h3-5,7-11H,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 186.2°C |
| Boiling Point: | 453.8°C at 760 mmHg |
| Density: | 1.172g/cm3 |
| Refractive index: | 1.692 |
| Specification: |
3-Methoxy-17-methyl-15H-cyclopentaphanthrene , its cas register number is 5831-08-3. It also can be called 15H-Cyclopenta(a)phenanthrene, 3-methoxy-17-methyl- ; BRN 2562404 ; and 3-Methoxy-17-methyl-15H-cyclopenta(a)phenanthrene . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 186.2°C |
| Safety Data | |
 |
|
