| Identification |
| Name: | 2-Thiophenecarboxaldehyde,3-methyl- |
| Synonyms: | 2-Formyl-3-methylthiophene;3-Methyl-2-formylthiophene;3-Methylthiophene-2-aldehyde;3-Methylthiophene-2-carboxaldehyde; |
| CAS: | 5834-16-2 |
| EINECS: | 227-418-8 |
| Molecular Formula: | C6H6OS |
| Molecular Weight: | 126.18 |
| InChI: | InChI=1/C6H6OS/c1-5-2-3-8-6(5)4-7/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.17 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.586-1.589 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow orange liquid. |
| HS Code: | 29349990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
