| Identification | |
| Name: | 3-Dibenzofuranamine,2-methoxy- |
| Synonyms: | (2-Methoxydibenzofuran-3-yl)amine;2-Methoxy-3-aminodibenzofuran; 3-Amino-2-methoxybenzofuran;3-Amino-2-methoxydibenzofuran |
| CAS: | 5834-17-3 |
| Molecular Formula: | C13H11 N O2 |
| Molecular Weight: | 213.25 |
| InChI: | InChI=1/C13H11NO2/c1-15-13-6-9-8-4-2-3-5-11(8)16-12(9)7-10(13)14/h2-7H,14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 92-94 °C(lit.) |
| Flash Point: | 190.3°C |
| Boiling Point: | 391°C at 760 mmHg |
| Density: | 1.278g/cm3 |
| Refractive index: | 1.709 |
| Specification: |
3-Dibenzofuranamine, 2-methoxy- with CAS registry number of 5834-17-3 is white to light yellow crystal powder. It is also known as 2-Amino-3-methoxydiphenylenoxyd ; 2-Amino-3-methoxydiphenylenoxyd [German] ; 2-Methoxy-3-aminodibenzofuran ; 3-Amino-2-methoxydibenzofuran ; 4-18-00-07352 (Beilstein Handbook Reference) . |
| Flash Point: | 190.3°C |
| Safety Data | |
 |
|
