| Identification | |
| Name: | 2(1H)-Pyrimidinone,6-amino-5-methyl-, hydrochloride (1:1) |
| Synonyms: | 4-Amino-5-methyl-1H-pyrimidin-2-one hydrochloride; |
| CAS: | 58366-64-6 |
| EINECS: | 261-223-9 |
| Molecular Formula: | C5H8ClN3O |
| Molecular Weight: | 161.5895 |
| InChI: | InChI=1/C5H7N3O.ClH/c1-3-2-7-5(9)8-4(3)6;/h2H,1H3,(H3,6,7,8,9);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 293-295ºC |
| Density: | 1.44g/cm3 |
| Stability: | This compound looses chloride readily. Keep container tightly closed, and store in freezer. |
| Appearance: | Crystalline |
| Specification: | Crystalline usageEng:A derivative of Dibarbituric acid. |
| Storage Temperature: | Store at RT. |
| Usage: | A derivative of Dibarbituric acid. |
| Safety Data | |
 |
|
