Identification |
Name: | Maleic anhydride,dihydroxy-, bis(3-chloropropionate) (7CI,8CI) |
Synonyms: | Propionicacid, 3-chloro-, diester with dihydroxymaleic anhydride |
CAS: | 5837-68-3 |
Molecular Formula: | C10H8 Cl2 O7 |
Molecular Weight: | 311.0723 |
InChI: | InChI=1/C10H8Cl2O7/c11-3-1-5(13)17-7-8(10(16)19-9(7)15)18-6(14)2-4-12/h1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 177.3°C |
Boiling Point: | 421.5°C at 760 mmHg |
Density: | 1.56g/cm3 |
Refractive index: | 1.528 |
Flash Point: | 177.3°C |
Safety Data |
|
 |