| Identification | |
| Name: | 2-Butenoic acid,2-methyl-, ethyl ester, (2E)- |
| Synonyms: | 2-Butenoicacid, 2-methyl-, ethyl ester, (E)-;Crotonic acid, 2-methyl-, ethyl ester, (E)-(8CI);Tiglic acid, ethyl ester (6CI,7CI);(E)-2-Methyl-2-butenoic acid ethylester;Ethyl tiglate;Ethyl a-methylcrotonate;NSC 55278; |
| CAS: | 5837-78-5 |
| EINECS: | 227-425-6 |
| Molecular Formula: | C7H12O2 |
| Molecular Weight: | 128.16898 |
| InChI: | InChI=1S/C7H12O2/c1-4-6(3)7(8)9-5-2/h4H,5H2,1-3H3/b6-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 0.923 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.4335-1.4355 |
| Water Solubility: | Slightly soluble in water |
| Solubility: | Slightly soluble in water |
| Appearance: | colorless liquid |
| Specification: | liquid Safety Statements:16-27-36/37/39 16:Keep away from sources of ignition - No smoking 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | Food additive. |
| Safety Data | |
 |
|
