Identification |
Name: | Inosine 5'-(trihydrogenpyrophosphate), 5'®5'-ester with 4-cyano-1,4-dihydro-1-b-D-ribofuranosylnicotinamide (8CI) |
Synonyms: | Inosinepyrophosphate, ester with 4-cyano-1,4-dihydro-1-b-D-ribofuranosylnicotinamide (6CI); Inosine,5'-pyrophosphate, 5'-ester with 4-cyano-1,4-dihydro-1-b-D-ribofuranosylnicotinamide(7CI); Nicotinamide-hypoxanthine dinucleotide, cyanide addn. compounds |
CAS: | 5839-31-6 |
Molecular Formula: | C22H27 N7 O15 P2 |
Molecular Weight: | 339.3022 |
InChI: | InChI=1/C17H13N3O5/c1-10-2-5-12(6-3-10)19-17(23)13(16(22)18-19)8-11-4-7-15(21)14(9-11)20(24)25/h2-9,21H,1H3,(H,18,22)/b13-8- |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.492g/cm3 |
Refractive index: | 1.715 |
Flash Point: | °C |
Safety Data |
|
 |