| Identification | |
| Name: | 2,3-dimethylhexane |
| Synonyms: | 2,3-dimethylhexane |
| CAS: | 584-94-1 |
| EINECS: | 209-547-1 |
| Molecular Formula: | C8H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H18/c1-5-6-8(4)7(2)3/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1262 |
| Flash Point: | 7 °C |
| Boiling Point: | 115 °C |
| Density: | 0.71 |
| Refractive index: | 1.399 |
| Specification: |
Its vapor and air can form explosive mixtures. Case heat and the fire is burning a risk of explosion. With a strong oxidant can respond. In the scene, heating containers risk of explosion. Its vapor is heavier than air, will spread to the lower Department of considerable local and met the fire will generate a return to burning. Combustion (decomposition) products are carbon monoxide, carbon dioxide. |
| Packinggroup: | O52 |
| Flash Point: | 7 °C |
| Safety Data | |
 |
|
