| Identification | |
| Name: | 2,8,9-trioxa-5-azonia-1-phosphabicyclo[3.3.3]undecane tetrafluoroborate |
| Synonyms: | 2,2',2''-Nitrilotriethanol, cyclic ester with hydrogen phosphite, tetrafluoroborate (1-);AC1L28GS;Ethanol, 2,2',2-nitrilotri-, cyclic ester with hydrogen phosphite, tetrafluoroborate (1-);LS-66968;4,6,11-trioxa-1-azonia-5-phosphabicyclo[3.3.3]undecane tetrafluoroborate;Ethanol, 2,2',2"-nitrilotri-, cyclic ester with hydrogen phosphite, tetrafluoroborate (1-);58418-99-8 |
| CAS: | 58418-99-8 |
| Molecular Formula: | C6H13BF4NO3P |
| Molecular Weight: | 264.9507 |
| InChI: | InChI=1/C6H12NO3P.BF4/c1-4-8-11-9-5-2-7(1)3-6-10-11;2-1(3,4)5/h1-6H2;/q;-1/p+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 71.7°C |
| Boiling Point: | 195°C at 760 mmHg |
| Flash Point: | 71.7°C |
| Safety Data | |
 |
|
