Identification |
Name: | D-Glucitol, 4-O-a-D-glucopyranosyl- |
Synonyms: | Glucitol,4-O-a-D-glucopyranosyl-, D- (8CI);Maltitol (6CI,7CI); Amalty; Amalty MR; Amalty MR 100; Amalty MR 20; Amalty MR50; Amalty P; Amalty Syrup; Cerestar 16303; D-Maltitol; Lesys; Lycasin HBC;Mabit; Malbit CH; Malbit CH 16385; Malbit CR; Malti MR; Maltidex 100; MaltidexH 16330; Maltisorb; Maltisorb P 200; Maltisorb P 35; Maltisorb P 90;Maltisweet; Maltisweet 3145; Maltit; Sweet G 2 |
CAS: | 585-88-6 |
EINECS: | 209-567-0 |
Molecular Formula: | C12H24O11 |
Molecular Weight: | 344.31 |
InChI: | InChI=1/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2 |
Molecular Structure: |
 |
Properties |
Density: | 1.69 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Appearance: | white to off-white solid |
Usage: | A dentally harmless sugar substitute. |
Safety Data |
|
 |