| Identification | |
| Name: | (R)-(-)-2-Amino-1-butanol |
| Synonyms: | 1-Butanol, 2-amino-, (2R)-; L-Amino-1-butanol |
| CAS: | 5856-63-3 |
| EINECS: | 227-476-4 |
| Molecular Formula: | C4H11NO |
| Molecular Weight: | 89.14 |
| InChI: | InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.944 |
| Refractive index: | 1.452 |
| Appearance: | clear, colorless Liquid |
| Specification: |
1-Butanol, 2-amino-,(2R)- , with CAS number of 5856-63-3, can be called (theta)-1-butano;1-butanol, 2-amino-, (r)-;2-amino-1-butanol, (r)-;2-aminobutanol ; l(-)-2-amino-1-butanol ; l-2-amino-1-butanol ; (r)(-)-2-aminobutanol ; (r)-(-)-2-amino-1-butanol . It is a clear colorless to light yellow viscous liquid. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive & Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
