Identification |
Name: | 9-Octadecenoic acid, 12-hydroxy-, [R-(Z)]-, ester with 1,2,3-propanetriol |
Synonyms: | 9-Octadecenoic acid, 12-hydroxy-, (R-(Z))-, ester with 1,2,3-propanetriol;2,3-dihydroxypropyl 5-hydroxy-2-octyldodecanoate |
CAS: | 58561-47-0 |
EINECS: | 261-327-4 |
Molecular Formula: | C23H46O5 |
Molecular Weight: | 402.6083 |
InChI: | InChI=1/C23H46O5/c1-3-5-7-9-11-12-14-20(23(27)28-19-22(26)18-24)16-17-21(25)15-13-10-8-6-4-2/h20-22,24-26H,3-19H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 167.3°C |
Boiling Point: | 530.1°C at 760 mmHg |
Density: | 0.993g/cm3 |
Refractive index: | 1.478 |
Flash Point: | 167.3°C |
Safety Data |
|
 |