| Identification | |
| Name: | Ethanone,1-(3-methoxyphenyl)- |
| Synonyms: | 3`-Methoxyacetophenone;Acetophenone,3'-methoxy- (8CI);1-(3-Methoxyphenyl)ethanone;1-Acetyl-3-methoxybenzene;3-Acetylanisole;3-Methoxyphenyl methyl ketone;Methyl 3-methoxyphenyl ketone;m-Acetylanisole;m-Methoxyacetophenone; |
| CAS: | 586-37-8 |
| EINECS: | 209-573-3 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-7(10)8-4-3-5-9(6-8)11-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to light. |
| Refractive index: | 1.5394-1.5414 |
| Solubility: | Slightly soluble |
| Appearance: | clear slightly yellow to slightly brown liquid |
| Specification: |
? Ethanone,1-(3-methoxyphenyl)- , with CAS number of 586-37-8, can be called 3`-Methoxyacetophenone ; Acetophenone,3'-methoxy- (8CI) ; 1-(3-Methoxyphenyl)ethanone ; 1-Acetyl-3-methoxybenzene ; 3-Methoxyphenyl methyl ketone ; Methyl 3-methoxyphenyl ketone ; m-Acetylanisole ; m-Methoxyacetophenone . It is a?clear slightly yellow to slightly brown liquid. |
| HS Code: | 29145000 |
| Storage Temperature: | Do not store in direct sunlight. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
 |
|
