| Identification | |
| Name: | 4-Bromoisopropylbenzene |
| Synonyms: | 1-Bromo-4-isopropylbenzene; 4-Bromocumene~4-Isopropylbromobenzene |
| CAS: | 586-61-8 |
| EINECS: | 209-577-5 |
| Molecular Formula: | C9H11Br |
| Molecular Weight: | 199.09 |
| InChI: | InChI=1/C9H11Br/c1-7(2)8-3-5-9(10)6-4-8/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | -22 °C |
| Density: | 1.286 |
| Refractive index: | 1.537 |
| Specification: | Safety Statements:60 60:This material and/or its container must be disposed of as hazardous waste |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
