| Identification | |
| Name: | Cyclohexene,1-methyl-4-(1-methylethylidene)- |
| Synonyms: | p-Mentha-1,4(8)-diene(8CI);1-Methyl-4-(1-methylethylidene)-cyclohexene;4-Isopropylidene-1-methylcyclohexene;Isoterpinene;Nofmer TP;Terpinolen;Terpinolene;a-Terpinolene;d-Terpinene; |
| CAS: | 586-62-9 |
| EINECS: | 209-578-0 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.23 |
| InChI: | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4H,5-7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2541 |
| Flash Point: | 148? |
| Density: | 0.861 |
| Stability: | No data. |
| Refractive index: | 1.489 |
| Solubility: | Insoluble |
| Appearance: | Water-white to pale amber liq. Sweet, pine odor. |
| Packinggroup: | III |
| Flash Point: | 148? |
| Storage Temperature: | 2-8°C |
| Color: | Water-white to pale amber liq COLORLESS TO VERY PALE, STRAW-YELLOW, OILY LIQ |
| Usage: | Solvent for resins, essential oils, manufacture of synthetic resins, chemical derivatives. |
| Safety Data | |
| Hazard Symbols | |
 |
|
