| Identification | |
| Name: | Benzoic acid,4,4'-(1,2-diazenediyl)bis- |
| Synonyms: | Benzoicacid, 4,4'-azobis- (9CI);Benzoic acid, 4,4'-azodi- (6CI,7CI,8CI);Benzoicacid, p,p'-azodi- (4CI);4,4'-Azobenzenedicarboxylic acid;4,4'-Azobisbenzoicacid;4,4'-Azodibenzoic acid;4-Azobenzoate; |
| CAS: | 586-91-4 |
| EINECS: | 209-589-0 |
| Molecular Formula: | C14H10N2O4 |
| Molecular Weight: | 270.24 |
| InChI: | InChI=1/C14H10N2O4/c17-13(18)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(19)20/h1-8H,(H,17,18)(H,19,20)/b16-15+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 281.1°C |
| Boiling Point: | 541.2°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.635 |
| Specification: |
4-Azobenzoate , its cas register number is 586-91-4. It also can be called 4,4'-Azobisbenzoic acid ; Azobenzene-4,4'-dicarboxylic Acid ; 4-[(4-Carboxyphenyl)diazenyl]benzoic acid ; and Benzoic acid, 4,4'-azobis- . |
| Flash Point: | 281.1°C |
| Safety Data | |
 |
|
