Identification |
Name: | Benzeneacetonitrile, a-methyl-4-(2-methylpropyl)- |
Synonyms: | 2-(4-Isobutylphenyl)propionitrile;2-(4'-Isobutylphenyl)propionitrile;2-[4-(2-Methylpropyl)phenyl]propanenitrile; |
CAS: | 58609-73-7 |
EINECS: | 261-365-1 |
Molecular Formula: | C13H17N |
Molecular Weight: | 187.28 |
InChI: | InChI=1/C13H17N/c1-10(2)8-12-4-6-13(7-5-12)11(3)9-14/h4-7,10-11H,8H2,1-3H3 |
Molecular Structure: |
|
Properties |
Transport: | UN3276 |
Density: | 0.94 g/cm3 |
Refractive index: | 1.505 |
Appearance: | colorless liquid. |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|