| Identification | |
| Name: | ethyl prop-2-enoate; prop-2-enoic acid; prop-1-en-2-ylbenzene |
| Synonyms: | AC1O57VC;2-Propenoic acid, polymer with ethyl 2-propenoate and (1-methylethenyl)benzene;ethyl prop-2-enoate; prop-2-enoic acid; prop-1-en-2-ylbenzene;(1-Methylethenyl)benzene, ethyl 2-propenoate, 2-propenoic acid polymer;58639-86-4 |
| CAS: | 58639-86-4 |
| Molecular Formula: | C17H22O4 |
| Molecular Weight: | 290.35418 |
| InChI: | InChI=1S/C9H10.C5H8O2.C3H4O2/c1-8(2)9-6-4-3-5-7-9;1-3-5(6)7-4-2;1-2-3(4)5/h3-7H,1H2,2H3;3H,1,4H2,2H3;2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 45.6°C |
| Boiling Point: | 162.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 45.6°C |
| Safety Data | |
 |
|
