| Identification | |
| Name: | 3-Methoxy-4-nitroazobenzene |
| Synonyms: | 3-Methoxy-4-nitroazobenzene |
| CAS: | 58683-84-4 |
| Molecular Formula: | C13H11N3O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C13H11N3O3/c1-19-13-9-11(7-8-12(13)16(17)18)15-14-10-5-3-2-4-6-10/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218°C |
| Boiling Point: | 436.9°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Specification: |
3-Methoxy-4-nitroazobenzene , its cas register number is 58683-84-4. It also can be called Diazene, (3-methoxy-4-nitrophenyl)phenyl- ; and Azobenzene, 3-methoxy-4-nitro- . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 218°C |
| Safety Data | |
 |
|
