| Identification | |
| Name: | 1-Octyn-3-ol, 4-ethyl- |
| Synonyms: | 4-Ethyl-1-octyn-3-ol;4-Ethyl-3-hydroxy-1-octyne;Ethyloctynol;NSC 62119; |
| CAS: | 5877-42-9 |
| EINECS: | C10H18O |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.24932 |
| InChI: | InChI=1S/C10H18O/c1-4-7-8-9(5-2)10(11)6-3/h3,9-11H,4-5,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 170kgs |
| Melting Point: | -45 C |
| Flash Point: | 84 C |
| Boiling Point: | 205 C |
| Density: | 0.878g/cm3 |
| Refractive index: | 1.455 |
| Water Solubility: | Immiscible AUTOIGNITION |
| Solubility: | Immiscible
AUTOIGNITION
Appearance:colorless
to slightly yellow liquid Transport Information:170kgs Hazard Symbols:UN NO. |
| Appearance: | colorless to slightly yellow liquid |
| Flash Point: | 84 C |
| Safety Data | |
| Hazard Symbols | |
 |
|
