| Identification | |
| Name: | Methoxyacetone |
| Synonyms: | Methoxy-2-propanone; 99%; Methoxyacetone (Methoxy-2-propanone) |
| CAS: | 5878-19-3 |
| EINECS: | 227-549-0 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-4(5)3-6-2/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.957 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.397-1.399 |
| Water Solubility: | miscible |
| Solubility: | Water Solubility miscible |
| Appearance: | Clear pale yellow to yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | Smoke dye. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
F: Flammable
|
 |
|
