| Identification | |
| Name: | 3-Hydroxyphenethylamine hydrochloride |
| Synonyms: | 3-(2-aminoethyl)phenol hydrochloride (1:1);Phenol, 3-(2-aminoethyl)-, hydrochloride (1:1);3-(2-aminoethyl)phenol hydrochloride;3-(2-Amino-ethyl)-phenol hydrochloride;3-(2-Aminoethyl)phenolhydrochloride; |
| CAS: | 588-05-6 |
| Molecular Formula: | C8H12ClNO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 140 °C |
| Flash Point: | 120.4°C |
| Boiling Point: | 275.5°Cat760mmHg |
| Density: | 1.103g/cm3 |
| Refractive index: | 1.577 |
| Specification: |
The 3-Hydroxyphenethylamine hydrochloride with the cas number 588-05-6 is also called 3-(2-aminoethyl)phenol hydrochloride (1:1). This product can be supplied by Shanghai Boka-chem Tech. Inc..The properties of the 3-Hydroxyphenethylamine hydrochloride are: (1)#H bond acceptors: 2; (2)#H bond donors: 3; (3)#Freely Rotating Bonds: 4; (4)Polar Surface Area: 12.47 Å2; (5)Flash Point: 120.4 °C; (6)Enthalpy of Vaporization: 53.46 kJ/mol; (7)Boiling Point: 275.5 °C at 760 mmHg; (8)Vapour Pressure: 0.00303 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 120.4°C |
| Color: | off-white to tan |
| Usage: | Brain microsomes were able to metabolize tyramine to dopamine. |
| Safety Data | |
 |
|
