| Identification | |
| Name: | Acetamide,N-(3-methoxyphenyl)- |
| Synonyms: | m-Acetanisidide(6CI,7CI,8CI); 3-Acetamidoanisole; 3-Methoxyacetanilide; 3'-Methoxyacetanilide;Aceto-m-anisidide; N-(3-Methoxyphenyl)acetamide; N-Acetyl-m-anisidine; NSC4005; m-Methoxyacetanilide |
| CAS: | 588-16-9 |
| EINECS: | 209-611-9 |
| Molecular Formula: | C9H11 N O2 |
| Molecular Weight: | 165.21 |
| InChI: | InChI=1/C9H11NO2/c1-7(11)10-8-4-3-5-9(6-8)12-2/h3-6H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 81 ºC |
| Flash Point: | 158.6 ºC |
| Boiling Point: | 338.7 ºC |
| Density: | 1.127 g/cm3 |
| Refractive index: | 1.557 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 158.6 ºC |
| Safety Data | |
 |
|
