Identification |
Name: | Acetic acid,2-(3,4-dichlorophenoxy)- |
Synonyms: | Aceticacid, (3,4-dichlorophenoxy)- (8CI,9CI); (3,4-Dichlorophenoxy)acetic acid;3,4-D; 3,4-DA; NSC 39017; NSC 525057 |
CAS: | 588-22-7 |
EINECS: | 209-612-4 |
Molecular Formula: | C8H6 Cl2 O3 |
Molecular Weight: | 221.04 |
InChI: | InChI=1/C8H6Cl2O3/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
Molecular Structure: |
|
Properties |
Transport: | 2811 |
Melting Point: | 138-140 °C(lit.)
|
Flash Point: | 166.3°C |
Boiling Point: | 351.4°Cat760mmHg |
Density: | 1.488g/cm3 |
Refractive index: | 1.572 |
Specification: |
Category: Pesticides
Flammable hazardous characteristics: burning of toxic chlorine gas
Storage features: Treasury ventilated, low-temperature, drying; separate from raw materials and food in transportation.
Fire-extinguishing agent: dry powder, foam, sand.
|
Packinggroup: | III |
Flash Point: | 166.3°C |
Storage Temperature: | APPROX 4°C |
Safety Data |
Hazard Symbols |
|
|
|