| Identification | |
| Name: | Acetamide,2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)- |
| Synonyms: | 3-(N-Chloracetyl-N-2,6-dimethylphenylamino)-g-butyrolactone;Milfuram;Ofurace;Ortho 20615;RE 20615; |
| CAS: | 58810-48-3 |
| EINECS: | 261-451-9 |
| Molecular Formula: | C14H16 Cl N O3 |
| Molecular Weight: | 281.76 |
| InChI: | InChI=1/C14H16ClNO3/c1-9-4-3-5-10(2)13(9)16(12(17)8-15)11-6-7-19-14(11)18/h3-5,11H,6-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 145 - 146 |
| Flash Point: | 245.8°C |
| Boiling Point: | 482.7°Cat760mmHg |
| Density: | 1.296g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.589 |
| Solubility: | Slightly. |
| Specification: |
2-Chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furyl)acetamide with CAS registry number of 58810-48-3 is known as (+-)-alpha-2-Chloro-N-2,6-xylylacetamido-gamma-butyrolactone ; 2-Chloro-2',6'-dimethyl-N-(2-oxotetrahydro-3-furyl)acetanilide ; 2-Chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide ; 5-18-11-00316 (Beilstein Handbook Reference) ; Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)- ; Acetanilide, 2-chloro-2',6'-dimethyl-N-(2-oxotetrahydro-3-furyl)- ; Chevron 20615 ; Milfuram ; Ofurace ; Ofurace [ANSI:BSI:ISO] ; Ortho 20615 ; RE 20615 . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide , Hydrogen chloride gas, Nitrogen oxides. |
| Flash Point: | 245.8°C |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Fungicide. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
