| Identification | |
| Name: | Benzoic acid,4-(dimethylamino)-, octyl ester |
| Synonyms: | Benzoicacid, p-(dimethylamino)-, octyl ester (7CI); Amerscol; OctylN,N-dimethyl-p-aminobenzoate; Octyl dimethyl PABA; Octyldimethyl-p-aminobenzoate; Octyl p-dimethylaminobenzoate |
| CAS: | 58817-05-3 |
| Molecular Formula: | C17H27 N O2 |
| Molecular Weight: | 277.45 |
| InChI: | InChI=1S/C17H27NO2/c1-4-5-6-7-8-9-14-20-17(19)15-10-12-16(13-11-15)18(2)3/h10-13H,4-9,14H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.1°C |
| Boiling Point: | 387.8°Cat760mmHg |
| Density: | 0.987g/cm3 |
| Specification: |
Amyldimethyl-p-amino benzoic acid ,its CAS number is 58817-05-3,it can be called Benzoic acid, p-dimethylamino-, octyl ester ; Padimite A ; Octyl-dimethyl-p-aminobenzoic acid . It is a toxic substance,with flammability, burning will produce toxic nitrogen oxides fumes,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 124.1°C |
| Safety Data | |
 |
|
