| Identification |
| Name: | 2-ethylhexanoic acid, compound with tributylamine (1:1) |
| Synonyms: | Hexanoic acid, 2-ethyl-, compd. with N,N-dibutyl-1-butanamine (1:1);Tributylammonium 2-ethylhexanoate;2-Ethylhexanoic acid, compound with tributylamine (1:1);2-ethylhexanoic acid - N,N-dibutylbutan-1-amine (1:1) |
| CAS: | 58823-74-8 |
| EINECS: | 261-460-8 |
| Molecular Formula: | C20H43NO2 |
| Molecular Weight: | 329.5609 |
| InChI: | InChI=1/C12H27N.C8H16O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-6-7(4-2)8(9)10/h4-12H2,1-3H3;7H,3-6H2,1-2H3,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 63.3°C |
| Boiling Point: | 215.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 63.3°C |
| Safety Data |
| |
 |
