| Identification | |
| Name: | 4-Ethylaniline |
| Synonyms: | 4-ethyl-Benzenamine |
| CAS: | 589-16-2 |
| EINECS: | 209-637-0 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-2-7-3-5-8(9)6-4-7/h3-6H,2,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1602 |
| Density: | 0.975 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5532-1.5552 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible with water |
| Appearance: | red-brown liquid |
| Specification: |
General Information: As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
