| Identification | |
| Name: | 1,4-Benzenedimethanol |
| Synonyms: | p-Xylene-a,a'-diol (6CI,7CI,8CI);1,4-Bis(hydroxymethyl)benzene;1,4-Di(hydroxymethyl)benzene;1,4-Dimethylolbenzene;1,4-Xylylene glycol;4-(Hydroxymethyl)benzenemethanol;4-(Hydroxymethyl)benzyl alcohol;NSC 5097;Terephthalyl alcohol;p-(Hydroxymethyl)benzyl alcohol;p-Benzenedimethanol;p-Bis(hydroxymethyl)benzene;p-Xylene glycol;p-Xylylene glycol;p-Xylylene-a,a'-diol;p-Xylylenediol;a,a'-Dihydroxy-p-xylene;a,a'-p-Xylenediol; |
| CAS: | 589-29-7 |
| EINECS: | 209-641-2 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c9-5-7-1-2-8(6-10)4-3-7/h1-4,9-10H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 151.3 ºC |
| Density: | 138 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | White to off-white crystalline powder. |
| HS Code: | 29062900 |
| Flash Point: | 151.3 ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
