| Identification | |
| Name: | 3-Hexanone |
| Synonyms: | Ethyl n-propyl ketone |
| CAS: | 589-38-8 |
| EINECS: | 209-645-4 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.15888 |
| InChI: | InChI=1S/C6H12O/c1-3-5-6(7)4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.815 |
| Stability: | Stable, but may form peroxides on prolonged storage. Flammable. Incompatible with oxidizing agents, reducing agents, strong bases. |
| Refractive index: | 1.399-1.401 |
| Water Solubility: | slightly soluble in water; soluble in acetone; soluble in alcohol and ether in all proportions |
| Solubility: | slightly soluble in water; soluble in acetone; soluble in alcohol and ether in all proportions |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:26-36-16-9-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 16:Keep away from sources of ignition - No smoking 9:Keep container in a well-ventilated place 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
