| Identification | |
| Name: | Cyclohexane,1,4-dimethyl- |
| Synonyms: | 1,4-Dimethylcyclohexane;NSC 44845; p-Dimethylcyclohexane |
| CAS: | 589-90-2 |
| EINECS: | 209-663-2 |
| Molecular Formula: | C8H16 |
| Molecular Weight: | 112.24 |
| InChI: | InChI=1/C8H16/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2263 3/PG 2 |
| Melting Point: | −87 °C(lit.) |
| Flash Point: | 15.6°C |
| Boiling Point: | 120 °C(lit.) |
| Density: | 0.766g/cm3 |
| Refractive index: | n20/D 1.426(lit.) |
| Water Solubility: | 3.84 mg l-1 |
| Specification: | clear colorless liquid Safety Statements:9-16-33-61-62 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 33:Take precautionary measures against static discharges 61:Avoid release to the environment. Refer to special instructions safety data sheet 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | II |
| Flash Point: | 15.6°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
