| Identification |
| Name: | Cyclohexanol, 4-methyl- |
| Synonyms: | 1-Methyl-4-cyclohexanol;4-Methyl-1-cyclohexanol;4-Methylcyclohexanol;4-Methylcyclohexyl alcohol;NSC3714; |
| CAS: | 589-91-3 |
| EINECS: | 209-664-8 |
| Molecular Formula: | C7H14O |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2617 |
| Density: | 0.914 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.457-1.459 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Colorless liquid. Exists in two geometrical isomers (cis and trans). Melting point: -9.2 C (cis). |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
