| Identification | |
| Name: | 5-Chloro-2-pentanone |
| Synonyms: | Chloropentanonetech; 3-Acetylpropyl chloride; 5-Chloropentan-2-one; 3-CHLOROPROPYL METHYL KETONE; 3-ACETYL-1-CHLOROPROPANE; ACETYLPROPYL CHLORIDE; 1-CHLORO-4-PENTANONE; METHYL 3-CHLOROPROPYL KETONE |
| CAS: | 5891-21-4 |
| EINECS: | 227-565-8 |
| Molecular Formula: | C5H9ClO |
| Molecular Weight: | 120.58 |
| InChI: | InChI=1/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Melting Point: | -48 |
| Density: | 1.053 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.437-1.446 |
| Solubility: | Soluble |
| Appearance: | Brown to black liquid |
| Specification: |
? 5-Chloro-2-pentanone (CAS NO.5891-21-4), its Synonyms are 1-Chloro-4-pentanone ; 2-Pentanone 5-chloro- ; 3-Chloropropyl methyl ketone . |
| Packinggroup: | III |
| HS Code: | 29147090 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
