| Identification | |
| Name: | 1-Propanol,3-(dibutylamino)-, 1-(4-aminobenzoate), hydrochloride (1:1) |
| Synonyms: | 1-Propanol,3-(dibutylamino)-, 4-aminobenzoate (ester), monohydrochloride (9CI);1-Propanol, 3-(dibutylamino)-, p-aminobenzoate (ester), monohydrochloride(8CI); Butacaine chloride; Butacaine hydrochloride |
| CAS: | 5892-15-9 |
| EINECS: | 227-568-4 |
| Molecular Formula: | C18H30 N2 O2 . Cl H |
| Molecular Weight: | 342.96 |
| InChI: | InChI=1/C18H30N2O2.ClH/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16;/h8-11H,3-7,12-15,19H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | 219.9°C |
| Boiling Point: | 440°C at 760 mmHg |
| Specification: |
Aminobenzoyldibutylaminopropanol hydrochloride ,its CAS number is 5892-15-9,it can be called p-Aminobenzoic acid 3-(dibutylamino)propyl ester hydrochloride ; 3-(Dibutylamino)propyl 4-aminobenzoate hydrochloride (1:1) ; 1-propanol, 3-(dibutylamino)-, 4-aminobenzoate (ester), hydrochloride (1:1) . It is a moderate substance,with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride,so it should be stored in cool and dry environment,separate from food and materials.Dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Packinggroup: | III |
| Flash Point: | 219.9°C |
| Safety Data | |
 |
|
